MASUDA Suction Line Filter element FR06-010SW
● Small and lightweight. (compared with the conventional VLM type, about half)
● Compact and high performance
● Internal structure is simple and flow resistance is small.
● Bypass mechanism is excellent in safety
● The clogging detector can be installed according to your needs. (optional)
● Can be installed on top of tank.
● Mounting flange for case is provided separately. (optional)
FILTER CODE
※ -FR※12- 10 P 12 F
※: Fluid type: NONE/ W/ F/ QE
※: Accessories: NONE/ M / E
12: Element size
10: Element accuracy
P : Element material
12: Connection diameter
F : Connection Type T/ FLANGE
ELEMENT CODE
FR04- 010 P - ※
010: Element accuracy
P : Element material
※: Fluid type: NONE/ W/ S / F / QE
MSY-04 -60M | APLE04-100S |
MSY-04 -100M | APLE04-100S |
MSY-04 -150M | APLE-04-500 |
MSY-04 -200M | APLE-04-500S |
MSY-04 -250M | APLE04-500S |
MSY-06 -60M | APLE20 |
MSY-06 -100M | W-APLE06F-20S-Z |
MSY-06 -150M | W-APLE06F-20S-Z |
MSY-06 -200M | W-APLS08F-100S |
MSY-06 -250M | W-APLS08F-100S |
MSY-08 -60M | W-APLS08F-100S-C |
MSY-08 -100M | W-APLS08F-100S-C |
MSY-08 -150M | W-APLS16F-10S |
MSY-08 -200M | W-APLS-16F-10S |
MSY-08 -250M | W-APLS16F-10S |
MSY-10 -60M | MSF-24-100M |
MSY-10 -100M | FR12-010SW |
MSY-10 -150M | FS08-100SW |
MSY-10 -200M | FS10-100SW |
MSY-24 -250M | VLF16-100A16F |
FSAS20F-10P | W-VLF16-100S-16F |
FRS16-20P-16F | F-FSS10-100S10F-LXN |
APLE04-500S | VLF32-100S32F-A |
OGM-6-60-YR | F06-020P-B |
VLR06-10P-E-H280 | F08-010P |
FR08-010P | F08-020P-B |
FRS06-20P06T | F12-010P |
FS08-100SW-F | F12010PB |
FRE20-10P-20F-LX | F12-010P-B |
W-APLE08-20S-C | F12-020P |
(F20-010P)VLFM20R-10P20FMFG | F12-040P, |
M24-010P-B | F16-020P |
F-FRS06-100S-06T | F16-020P-B |
F16-100SW-W | F16-040P |
F-FPME06-20S-036-X | F20-020P-B |
T06-020P | F4820P |
A16-010SW-W | F-FRS04-10P04FF |
FR16-010P(FRS-16-10-P16F) | FHLME506-205067100P |
FRS-16-10-P16F | FLR06-20P-S |
FRS-16-10P16F | FPL-06-10P |
APLS20F-10P | FPL-08P26-010P |
A20-010P | FPME04-10P |
FR24-010P | FRS16-20P-16FLX-6 |
FR10-020SW | FRS16-20P16F-LXN |
FRS24-10P20F-Lx | FRS10-20P10F |
FRS10-20S10F | FRS20-20P20F-049 PLATE NO:78130 |
FR24-010P | G01-010P |
FR10-020SW | LMTE-20-20P-20F |
HNC2-2.5S-2 | LMTS32-40P32F-S1 |
MSN-24-150M | M32-010P |
MSN-20-150M | MAR08-10P-11-H255 |
VLFME16R-10P16F-C | OFI-G01-P10P-1 |
FR12-020P | OFI-G01-P10P-S |
ER-04-010P(FR04-010P) | OFI-GO1-P10P-S |
A10-020P-W | RME32R-10P-32F |
T24-075SW | T32-040P-S |
APLE20APLS20 | Type:FLR06-20P-S |
APLE20APLS20 | VLF-24-10P |
APLE20F-10P | VLF24-10P24F |
APLE-20F-10P | VLF-24-10P现VLF24-10P24F |
APLE-20F-10P | VLFE16R-20P16F-B |
APLS 20F-10P | VLFE-16R-20P16F-C |
APLS04-5S | VLFE-16R-20P16F-G |
APLS04-5S | VLFME20R-10P20FMFG |
APLS08-20P | F24-100SW |
APLS08-20P | F-FRS10-20P10F-LXN |
APLS10F-20P | W-FPMS06-40P |
APLS10F-20P | FPME04-10P-C |
APLS-16-105S | FPME04-10PMFG |
APLS16F-20S | FPME04-10PMFGNO.101003 |
APLS16F-20S | FR06-010P |
APLS20 | FR06-020P |
APLS-20-105S | FR08-020P |
APLS-20-10P | FR08-020P-W |
APLS20F-10P | FR10-010P |
F-APL16F-50S-Z | FR10-020P |
F-APL16F-50S-Z | FR-10-O20P |
F-APLE06-400S | FR16-010P |
F-APLE06-400S | FR16-020P |
F-APLE12-25S | FR16-20P |
F-APLE12-25S | FR20-010P |
F-APLS06-5S | FRE04-10P04T |
F-APLS-08-150S | FRE06-10P06T |
VLM04R-150A04T | FRE16-20P16F |
W-APL12F-20S | FRE16-20P16F-049 |
W-APL12F-20S | FRS06-10PO6T |
F12-100SW | FRS06-20P06T-K-370 |
VLFE20R-20P20F-B | FRS08-010P |
VLFE20R-20P20F-C | FRS08-10P-08T |
VLF 16R-20P16F-B | FRS-08-10P-08T |
F-FRS10-10P10F-LXN | FRS10-10P10F-CX |
VLR06-10P-E-n280 | FRS10-10P10F-LX |
F-FS08-500S08T-Z-LX-564 | FRS12-10P12F-LXN |
MSY-10 -250M | M24-100SW |
MSY-12 -60M | VLFME-16R-20P-16F |
MSY-12 -100M | W-RME32R-10P-24F |
MSY-12 -150M | W-VLFM-24R-20P-24F |
MSY-12 -200M | FRS-12R-20P12F |
MSY-12 -250M | MSF-24 |
MSY-16 -60M | MSF-16 |
MSY-16 -100M | A16-10SW-W |
MSY-16 -150M | A08-010SW-W |
MSY-16 -200M | M24-010P |
MSY-16 -250M | R06-010P |
MSY-20 -60M | M32-100SW |
MSY-20 -100M | P26-400SW-W |
MSY-20 -150M | LMTs32-40P32F-S1(T32-040P-S1) |
MSY-20 -200M | FS08-150SW-L150 |
MSY-20 -250M | FRS16-10916F |
MSY-24 -60M | F-FRS08-3P08F(FR08-003P-F) |
MSY-24 -100M | FRS16-10SW-16F |
MSY-24 -150M | FRS12-10SW-12F |
MSY-24 -200M | W-APLS12-20P-790-C |
FRS12-20P12F | FR16-010SW |
LMT MS04-20P04N | F40-100SW |
FR12-010P | VLF40-100S40F-A-L1-VE |
LPF-08 | VLF16R-20P16F-B |
F20-100SW | VLF-16R-20P16F-B |
W-FPL-06-400S | |
FS16-300S-16F (FS16-300SW) | HT-728-02 |
A04-500SW | FRS16-10SW-16F(FR16-010SW) |
FS08-500SW-F | FRS12-10SW-12F(FR12-010SW |
VLR06-10P-E-H200 | VLFE24R-10P24F(10μ)(F24-010P) |
APLE-16-10S | F16-100SW |
W-APLE08-40S-C | F40-100SW (for VLF40-100S40F-A-L1-VE) |
A08-040SW-W | VLFE16R-20P16F |
A12-025SW-F(F-APLE12-25S) | FR06-010SW |
MSA-V50-VS10 | FR16-010SW(FRS16-10SW-16F) |
MSN-32-150K(MSN-31-11 | W-FSS-08-100S08T-U |
F12-040P | W-VLF16-10S-16F |
VLFE12R-40P12F | F32-100SW(VLF32-100S32F-A) |
A08-020SW-W | W-APL12F10-25S-018(OEM) |
MAR10-10P-S-13 | W-APLE08F-300S-018(OEM) |
VLFE24R-10P24F(10μ) | W-FPME08-300S |
A16-010SW | A08-300SW-W |
F-VLFE06-100S06T | A12-025SW-W |
F-FPME06-20S-036-X-C | FR20-020P |
FRS20-10P16F-LX | MSA-650N |
FRS20-20P-20FLX | VLFE16-10S16F |
FRS16-10P16F-LX | FR12-010PC |
FRS16-10P-16F-LX | FRS10-10P-10F |
A03-005P | FRS16-10P-16F |
A03-005P | A16-010P(APL-S16F-10P) |
A03-010P | A12-010P(APL-S12F-10P) |
A03-010P | VLF20-100S20F-C |
A03-010SW | FR16-020SW-W(W-FRS16-20S16F) |
A04-020SW | FR08-100SW(FRS-08-100S-08T) |
A04-100SW | F16-10SW-W |
A04-100SW | VLF16R-10P16F-B(A16-010SW-W) |
A06-020SW | FR20-020SW-W |
A06-020SW-F | W-APLE08-20S |
A06-020SW-F 20UM | VLF40-100S40F |
A06-020SW-F 20UM | MSA-100N |
A06-020SW-F | F06-200AN |
A06-020SW-F1 | A16-010SW |
A06-020SW-F1 | W-APLE10-20S |
A08-020SW | A10-020SW-W |
A08-150S | M48-075SW-G-S-L700 |
A16-105SW | |
A20-105SW | |
2012-12-18
2012-12-18
Service process
CONTACT US
TEL: (0086) 0755 28211180
E-MAIL: wuqi913@hotmail.com
ADDRESS: Rm A708,Jietai Building,Busha Road No.13,Longgang District,Shenzhen,
Guangdong Province, China ,518114
HELP
Copyright © 2023 KeepParts. All Rights Reserved